About tert-butyl 2-(1,4-diacetyloxynaphthalen-2-yl)-3-oxo-1H-indene-2-carboxylate
tert-butyl 2-(1,4-diacetyloxynaphthalen-2-yl)-3-oxo-1H-indene-2-carboxylate (PubChem CID 134833199) has the molecular formula C28H26O7
and a molecular weight of 474.51 g/mol. Its IUPAC name is tert-butyl 2-(1,4-diacetyloxynaphthalen-2-yl)-3-oxo-1H-indene-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-(1,4-diacetyloxynaphthalen-2-yl)-3-oxo-1H-indene-2-carboxylate |
| PubChem CID | 134833199 |
| Molecular Formula | C28H26O7 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | tert-butyl 2-(1,4-diacetyloxynaphthalen-2-yl)-3-oxo-1H-indene-2-carboxylate |
| SMILES | CC(=O)Oc1cc(C2(C(=O)OC(C)(C)C)Cc3ccccc3C2=O)c(OC(C)=O)c2ccccc12 |
| InChI | InChI=1S/C28H26O7/c1-16(29)33-23-14-22(24(34-17(2)30)21-13-9-8-12-20(21)23)28(26(32)35-27(3,4)5)15-18-10-6-7-11-19(18)25(28)31/h6-14H,15H2,1-5H3 |
| InChIKey | ISJIKFGVFHIVBL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(1,4-diacetyloxynaphthalen-2-yl)-3-oxo-1H-indene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(1,4-diacetyloxynaphthalen-2-yl)-3-oxo-1H-indene-2-carboxylate?
The IUPAC name of tert-butyl 2-(1,4-diacetyloxynaphthalen-2-yl)-3-oxo-1H-indene-2-carboxylate (CID 134833199) is tert-butyl 2-(1,4-diacetyloxynaphthalen-2-yl)-3-oxo-1H-indene-2-carboxylate.
What is the SMILES notation for tert-butyl 2-(1,4-diacetyloxynaphthalen-2-yl)-3-oxo-1H-indene-2-carboxylate?
The canonical SMILES for tert-butyl 2-(1,4-diacetyloxynaphthalen-2-yl)-3-oxo-1H-indene-2-carboxylate is CC(=O)Oc1cc(C2(C(=O)OC(C)(C)C)Cc3ccccc3C2=O)c(OC(C)=O)c2ccccc12.
What is the InChIKey of tert-butyl 2-(1,4-diacetyloxynaphthalen-2-yl)-3-oxo-1H-indene-2-carboxylate?
The InChIKey is ISJIKFGVFHIVBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26O7/c1-16(29)33-23-14-22(24(34-17(2)30)21-13-9-8-12-20(21)23)28(26(32)35-27(3,4)5)15-18-10-6-7-11-19(18)25(28)31/h6-14H,15H2,1-5H3.
What are the key properties of tert-butyl 2-(1,4-diacetyloxynaphthalen-2-yl)-3-oxo-1H-indene-2-carboxylate?
tert-butyl 2-(1,4-diacetyloxynaphthalen-2-yl)-3-oxo-1H-indene-2-carboxylate has a molecular weight of 474.51 g/mol, XLogP of 4.71, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(1,4-diacetyloxynaphthalen-2-yl)-3-oxo-1H-indene-2-carboxylate is sourced from PubChem (CID 134833199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).