C37H39NO5S2 — CID 134833200
O-[(3aS,4S,5R,6S,6aS)-1-benzyl-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-yl] methylsulfanylmethanethioate (PubChem CID 134833200) has the molecular formula C37H39NO5S2 and a molecular weight of 641.86 g/mol. Its IUPAC name is O-[(3aS,4S,5R,6S,6aS)-1-benzyl-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-yl] methylsulfanylmethanethioate.
| Compound Name | O-[(3aS,4S,5R,6S,6aS)-1-benzyl-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-yl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 134833200 |
| Molecular Formula | C37H39NO5S2 |
| Molecular Weight | 641.86 g/mol |
| Exact Mass | 641.23 |
| IUPAC Name | O-[(3aS,4S,5R,6S,6aS)-1-benzyl-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-yl] methylsulfanylmethanethioate |
| SMILES | CSC(=S)O[C@]1(COCc2ccccc2)[C@@H]2CON(Cc3ccccc3)[C@@H]2[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H39NO5S2/c1-45-36(44)43-37(27-39-23-29-16-8-3-9-17-29)32-26-42-38(22-28-14-6-2-7-15-28)33(32)34(40-24-30-18-10-4-11-19-30)35(37)41-25-31-20-12-5-13-21-31/h2-21,32-35H,22-27H2,1H3/t32-,33+,34+,35-,37-/m1/s1 |
| InChIKey | UCVNHZMSAFXNKQ-YJOVGYIHSA-N |
| XLogP | 7.22 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.86 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|