C12H15BrO2 — CID 134833207
(1R,2R)-7-bromo-1,2-dimethoxy-1,2,3,4-tetrahydronaphthalene (PubChem CID 134833207) has the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. Its IUPAC name is (1R,2R)-7-bromo-1,2-dimethoxy-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1R,2R)-7-bromo-1,2-dimethoxy-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 134833207 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | (1R,2R)-7-bromo-1,2-dimethoxy-1,2,3,4-tetrahydronaphthalene |
| SMILES | CO[C@@H]1c2cc(Br)ccc2CC[C@H]1OC |
| InChI | InChI=1S/C12H15BrO2/c1-14-11-6-4-8-3-5-9(13)7-10(8)12(11)15-2/h3,5,7,11-12H,4,6H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | NBQVPWKQXBAYPB-VXGBXAGGSA-N |
| XLogP | 3.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |