C26H46O3S2Si — CID 134833244
(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[2-[2-(4-methoxyphenyl)ethyl]-1,3-dithian-2-yl]heptan-2-ol (PubChem CID 134833244) has the molecular formula C26H46O3S2Si and a molecular weight of 498.87 g/mol. Its IUPAC name is (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[2-[2-(4-methoxyphenyl)ethyl]-1,3-dithian-2-yl]heptan-2-ol.
| Compound Name | (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[2-[2-(4-methoxyphenyl)ethyl]-1,3-dithian-2-yl]heptan-2-ol |
|---|---|
| PubChem CID | 134833244 |
| Molecular Formula | C26H46O3S2Si |
| Molecular Weight | 498.87 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[2-[2-(4-methoxyphenyl)ethyl]-1,3-dithian-2-yl]heptan-2-ol |
| SMILES | CCC[C@H](C[C@@H](O)CC1(CCc2ccc(OC)cc2)SCCCS1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46O3S2Si/c1-8-10-24(29-32(6,7)25(2,3)4)19-22(27)20-26(30-17-9-18-31-26)16-15-21-11-13-23(28-5)14-12-21/h11-14,22,24,27H,8-10,15-20H2,1-7H3/t22-,24-/m1/s1 |
| InChIKey | PLJSFGUOICDOGH-ISKFKSNPSA-N |
| XLogP | 7.53 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.87 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|