About tert-butyl-[2-(3,6-dihydro-2H-pyran-6-yl)ethoxy]-diphenylsilane
tert-butyl-[2-(3,6-dihydro-2H-pyran-6-yl)ethoxy]-diphenylsilane (PubChem CID 134833273) has the molecular formula C23H30O2Si
and a molecular weight of 366.58 g/mol. Its IUPAC name is tert-butyl-[2-(3,6-dihydro-2H-pyran-6-yl)ethoxy]-diphenylsilane.
Molecular Properties
| Compound Name | tert-butyl-[2-(3,6-dihydro-2H-pyran-6-yl)ethoxy]-diphenylsilane |
| PubChem CID | 134833273 |
| Molecular Formula | C23H30O2Si |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | tert-butyl-[2-(3,6-dihydro-2H-pyran-6-yl)ethoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCC1C=CCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30O2Si/c1-23(2,3)26(21-13-6-4-7-14-21,22-15-8-5-9-16-22)25-19-17-20-12-10-11-18-24-20/h4-10,12-16,20H,11,17-19H2,1-3H3 |
| InChIKey | VDDIFINKGFNHSO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[2-(3,6-dihydro-2H-pyran-6-yl)ethoxy]-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[2-(3,6-dihydro-2H-pyran-6-yl)ethoxy]-diphenylsilane?
The IUPAC name of tert-butyl-[2-(3,6-dihydro-2H-pyran-6-yl)ethoxy]-diphenylsilane (CID 134833273) is tert-butyl-[2-(3,6-dihydro-2H-pyran-6-yl)ethoxy]-diphenylsilane.
What is the SMILES notation for tert-butyl-[2-(3,6-dihydro-2H-pyran-6-yl)ethoxy]-diphenylsilane?
The canonical SMILES for tert-butyl-[2-(3,6-dihydro-2H-pyran-6-yl)ethoxy]-diphenylsilane is CC(C)(C)[Si](OCCC1C=CCCO1)(c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butyl-[2-(3,6-dihydro-2H-pyran-6-yl)ethoxy]-diphenylsilane?
The InChIKey is VDDIFINKGFNHSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30O2Si/c1-23(2,3)26(21-13-6-4-7-14-21,22-15-8-5-9-16-22)25-19-17-20-12-10-11-18-24-20/h4-10,12-16,20H,11,17-19H2,1-3H3.
What are the key properties of tert-butyl-[2-(3,6-dihydro-2H-pyran-6-yl)ethoxy]-diphenylsilane?
tert-butyl-[2-(3,6-dihydro-2H-pyran-6-yl)ethoxy]-diphenylsilane has a molecular weight of 366.58 g/mol, XLogP of 4.30, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[2-(3,6-dihydro-2H-pyran-6-yl)ethoxy]-diphenylsilane is sourced from PubChem (CID 134833273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).