C28H32N2O4 — CID 134833358
1-[(3R,4R,5R)-4,5-bis(phenylmethoxy)-3-(phenylmethoxymethyl)diazinan-1-yl]ethanone (PubChem CID 134833358) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is 1-[(3R,4R,5R)-4,5-bis(phenylmethoxy)-3-(phenylmethoxymethyl)diazinan-1-yl]ethanone.
| Compound Name | 1-[(3R,4R,5R)-4,5-bis(phenylmethoxy)-3-(phenylmethoxymethyl)diazinan-1-yl]ethanone |
|---|---|
| PubChem CID | 134833358 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 1-[(3R,4R,5R)-4,5-bis(phenylmethoxy)-3-(phenylmethoxymethyl)diazinan-1-yl]ethanone |
| SMILES | CC(=O)N1C[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)N1 |
| InChI | InChI=1S/C28H32N2O4/c1-22(31)30-17-27(33-19-24-13-7-3-8-14-24)28(34-20-25-15-9-4-10-16-25)26(29-30)21-32-18-23-11-5-2-6-12-23/h2-16,26-29H,17-21H2,1H3/t26-,27-,28-/m1/s1 |
| InChIKey | JGAAJJISXPLLPP-JCYYIGJDSA-N |
| XLogP | 4.11 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |