C17H26O2Si — CID 134833385
tert-butyl-[(E)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-3-en-1,5-diynyl]-dimethylsilane (PubChem CID 134833385) has the molecular formula C17H26O2Si and a molecular weight of 290.48 g/mol. Its IUPAC name is tert-butyl-[(E)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-3-en-1,5-diynyl]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-3-en-1,5-diynyl]-dimethylsilane |
|---|---|
| PubChem CID | 134833385 |
| Molecular Formula | C17H26O2Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | tert-butyl-[(E)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-3-en-1,5-diynyl]-dimethylsilane |
| SMILES | C#C/C(=C\C#C[Si](C)(C)C(C)(C)C)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H26O2Si/c1-9-14(15-13-18-17(5,6)19-15)11-10-12-20(7,8)16(2,3)4/h1,11,15H,13H2,2-8H3/b14-11+/t15-/m0/s1 |
| InChIKey | BCIHSUDWAOMOKU-GOFCXVBSSA-N |
| XLogP | 3.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|