C16H24O7 — CID 134833433
[(3aR,5S)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]methyl prop-2-enoate (PubChem CID 134833433) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is [(3aR,5S)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]methyl prop-2-enoate.
| Compound Name | [(3aR,5S)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 134833433 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | [(3aR,5S)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1C2OC(C)(C)O[C@H]2O[C@@H]1C1COC(C)(C)O1 |
| InChI | InChI=1S/C16H24O7/c1-6-11(17)18-7-9-12(10-8-19-15(2,3)21-10)20-14-13(9)22-16(4,5)23-14/h6,9-10,12-14H,1,7-8H2,2-5H3/t9?,10?,12-,13?,14+/m0/s1 |
| InChIKey | JQXVZLKDUXZKOS-DMZXHLKXSA-N |
| XLogP | 1.36 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|