C8H14O — CID 134833489
(2S,3S,4S)-2,3,4-trimethyl-3,4-dihydro-2H-pyran (PubChem CID 134833489) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (2S,3S,4S)-2,3,4-trimethyl-3,4-dihydro-2H-pyran.
| Compound Name | (2S,3S,4S)-2,3,4-trimethyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 134833489 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (2S,3S,4S)-2,3,4-trimethyl-3,4-dihydro-2H-pyran |
| SMILES | C[C@@H]1[C@H](C)OC=C[C@@H]1C |
| InChI | InChI=1S/C8H14O/c1-6-4-5-9-8(3)7(6)2/h4-8H,1-3H3/t6-,7-,8-/m0/s1 |
| InChIKey | HUWOYERDLHTEID-FXQIFTODSA-N |
| XLogP | 2.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |