About 1-hex-5-enyl-3,4-dihydropyridin-2-one
1-hex-5-enyl-3,4-dihydropyridin-2-one (PubChem CID 134833525) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-hex-5-enyl-3,4-dihydropyridin-2-one.
Molecular Properties
| Compound Name | 1-hex-5-enyl-3,4-dihydropyridin-2-one |
| PubChem CID | 134833525 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1-hex-5-enyl-3,4-dihydropyridin-2-one |
| SMILES | C=CCCCCN1C=CCCC1=O |
| InChI | InChI=1S/C11H17NO/c1-2-3-4-6-9-12-10-7-5-8-11(12)13/h2,7,10H,1,3-6,8-9H2 |
| InChIKey | HUNFKUYXRBCTSD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hex-5-enyl-3,4-dihydropyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hex-5-enyl-3,4-dihydropyridin-2-one?
The IUPAC name of 1-hex-5-enyl-3,4-dihydropyridin-2-one (CID 134833525) is 1-hex-5-enyl-3,4-dihydropyridin-2-one.
What is the SMILES notation for 1-hex-5-enyl-3,4-dihydropyridin-2-one?
The canonical SMILES for 1-hex-5-enyl-3,4-dihydropyridin-2-one is C=CCCCCN1C=CCCC1=O.
What is the InChIKey of 1-hex-5-enyl-3,4-dihydropyridin-2-one?
The InChIKey is HUNFKUYXRBCTSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-2-3-4-6-9-12-10-7-5-8-11(12)13/h2,7,10H,1,3-6,8-9H2.
What are the key properties of 1-hex-5-enyl-3,4-dihydropyridin-2-one?
1-hex-5-enyl-3,4-dihydropyridin-2-one has a molecular weight of 179.26 g/mol, XLogP of 2.48, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hex-5-enyl-3,4-dihydropyridin-2-one is sourced from PubChem (CID 134833525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).