C15H17NO4 — CID 134833543
(6R,7R,7aR)-6-methyl-3-oxo-7-phenylmethoxy-1,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-7a-carbaldehyde (PubChem CID 134833543) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is (6R,7R,7aR)-6-methyl-3-oxo-7-phenylmethoxy-1,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-7a-carbaldehyde.
| Compound Name | (6R,7R,7aR)-6-methyl-3-oxo-7-phenylmethoxy-1,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-7a-carbaldehyde |
|---|---|
| PubChem CID | 134833543 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (6R,7R,7aR)-6-methyl-3-oxo-7-phenylmethoxy-1,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-7a-carbaldehyde |
| SMILES | C[C@@H]1CN2C(=O)OC[C@]2(C=O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C15H17NO4/c1-11-7-16-14(18)20-10-15(16,9-17)13(11)19-8-12-5-3-2-4-6-12/h2-6,9,11,13H,7-8,10H2,1H3/t11-,13-,15-/m1/s1 |
| InChIKey | MBDPBJSANGHEFZ-UXIGCNINSA-N |
| XLogP | 1.61 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|