C33H38O9 — CID 134833602
dimethyl 2-[(2R,5S)-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]propanedioate (PubChem CID 134833602) has the molecular formula C33H38O9 and a molecular weight of 578.66 g/mol. Its IUPAC name is dimethyl 2-[(2R,5S)-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]propanedioate.
| Compound Name | dimethyl 2-[(2R,5S)-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]propanedioate |
|---|---|
| PubChem CID | 134833602 |
| Molecular Formula | C33H38O9 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | dimethyl 2-[(2R,5S)-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C1C(OCc2ccccc2)[C@H](OCc2ccccc2)C(COCc2ccccc2)O[C@H]1OC |
| InChI | InChI=1S/C33H38O9/c1-36-31(34)28(32(35)37-2)27-30(41-21-25-17-11-6-12-18-25)29(40-20-24-15-9-5-10-16-24)26(42-33(27)38-3)22-39-19-23-13-7-4-8-14-23/h4-18,26-30,33H,19-22H2,1-3H3/t26?,27?,29-,30?,33-/m1/s1 |
| InChIKey | CCHMDSBUKXRWOP-IGBNYOGYSA-N |
| XLogP | 4.32 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|