About 2-but-3-enyl-5,6-dihydro-4H-cyclopenta[b]furan
2-but-3-enyl-5,6-dihydro-4H-cyclopenta[b]furan (PubChem CID 13483361) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 2-but-3-enyl-5,6-dihydro-4H-cyclopenta[b]furan.
Molecular Properties
| Compound Name | 2-but-3-enyl-5,6-dihydro-4H-cyclopenta[b]furan |
| PubChem CID | 13483361 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 2-but-3-enyl-5,6-dihydro-4H-cyclopenta[b]furan |
| SMILES | C=CCCc1cc2c(o1)CCC2 |
| InChI | InChI=1S/C11H14O/c1-2-3-6-10-8-9-5-4-7-11(9)12-10/h2,8H,1,3-7H2 |
| InChIKey | CTSJCDFFIBVHMF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-but-3-enyl-5,6-dihydro-4H-cyclopenta[b]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-3-enyl-5,6-dihydro-4H-cyclopenta[b]furan?
The IUPAC name of 2-but-3-enyl-5,6-dihydro-4H-cyclopenta[b]furan (CID 13483361) is 2-but-3-enyl-5,6-dihydro-4H-cyclopenta[b]furan.
What is the SMILES notation for 2-but-3-enyl-5,6-dihydro-4H-cyclopenta[b]furan?
The canonical SMILES for 2-but-3-enyl-5,6-dihydro-4H-cyclopenta[b]furan is C=CCCc1cc2c(o1)CCC2.
What is the InChIKey of 2-but-3-enyl-5,6-dihydro-4H-cyclopenta[b]furan?
The InChIKey is CTSJCDFFIBVHMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-2-3-6-10-8-9-5-4-7-11(9)12-10/h2,8H,1,3-7H2.
What are the key properties of 2-but-3-enyl-5,6-dihydro-4H-cyclopenta[b]furan?
2-but-3-enyl-5,6-dihydro-4H-cyclopenta[b]furan has a molecular weight of 162.23 g/mol, XLogP of 2.89, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-3-enyl-5,6-dihydro-4H-cyclopenta[b]furan is sourced from PubChem (CID 13483361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).