About 2-phenylsulfanyl-5H-1,3-thiazol-5-ide;zinc
2-phenylsulfanyl-5H-1,3-thiazol-5-ide;zinc (PubChem CID 134833636) has the molecular formula C9H6NS2Zn-
and a molecular weight of 257.68 g/mol. Its IUPAC name is 2-phenylsulfanyl-5H-1,3-thiazol-5-ide;zinc.
Molecular Properties
| Compound Name | 2-phenylsulfanyl-5H-1,3-thiazol-5-ide;zinc |
| PubChem CID | 134833636 |
| Molecular Formula | C9H6NS2Zn- |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 255.92 |
| IUPAC Name | 2-phenylsulfanyl-5H-1,3-thiazol-5-ide;zinc |
| SMILES | [Zn].[c-]1cnc(Sc2ccccc2)s1 |
| InChI | InChI=1S/C9H6NS2.Zn/c1-2-4-8(5-3-1)12-9-10-6-7-11-9;/h1-6H;/q-1; |
| InChIKey | IMCGWBQADPWOTR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylsulfanyl-5H-1,3-thiazol-5-ide;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanyl-5H-1,3-thiazol-5-ide;zinc?
The IUPAC name of 2-phenylsulfanyl-5H-1,3-thiazol-5-ide;zinc (CID 134833636) is 2-phenylsulfanyl-5H-1,3-thiazol-5-ide;zinc.
What is the SMILES notation for 2-phenylsulfanyl-5H-1,3-thiazol-5-ide;zinc?
The canonical SMILES for 2-phenylsulfanyl-5H-1,3-thiazol-5-ide;zinc is [Zn].[c-]1cnc(Sc2ccccc2)s1.
What is the InChIKey of 2-phenylsulfanyl-5H-1,3-thiazol-5-ide;zinc?
The InChIKey is IMCGWBQADPWOTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6NS2.Zn/c1-2-4-8(5-3-1)12-9-10-6-7-11-9;/h1-6H;/q-1;.
What are the key properties of 2-phenylsulfanyl-5H-1,3-thiazol-5-ide;zinc?
2-phenylsulfanyl-5H-1,3-thiazol-5-ide;zinc has a molecular weight of 257.68 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanyl-5H-1,3-thiazol-5-ide;zinc is sourced from PubChem (CID 134833636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).