About 2-(2-methoxyethenyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene
2-(2-methoxyethenyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene (PubChem CID 134833668) has the molecular formula C12H18O
and a molecular weight of 178.28 g/mol. Its IUPAC name is 2-(2-methoxyethenyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene.
Molecular Properties
| Compound Name | 2-(2-methoxyethenyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene |
| PubChem CID | 134833668 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 2-(2-methoxyethenyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene |
| SMILES | COC=CC1=CCC2CC1C2(C)C |
| InChI | InChI=1S/C12H18O/c1-12(2)10-5-4-9(6-7-13-3)11(12)8-10/h4,6-7,10-11H,5,8H2,1-3H3 |
| InChIKey | ALMYJXNMNJQHCJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyethenyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethenyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene?
The IUPAC name of 2-(2-methoxyethenyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene (CID 134833668) is 2-(2-methoxyethenyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene.
What is the SMILES notation for 2-(2-methoxyethenyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene?
The canonical SMILES for 2-(2-methoxyethenyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene is COC=CC1=CCC2CC1C2(C)C.
What is the InChIKey of 2-(2-methoxyethenyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene?
The InChIKey is ALMYJXNMNJQHCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-12(2)10-5-4-9(6-7-13-3)11(12)8-10/h4,6-7,10-11H,5,8H2,1-3H3.
What are the key properties of 2-(2-methoxyethenyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene?
2-(2-methoxyethenyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene has a molecular weight of 178.28 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethenyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene is sourced from PubChem (CID 134833668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).