About 2-methoxy-N-(5-methyl-1,2-oxazol-4-yl)acetamide
2-methoxy-N-(5-methyl-1,2-oxazol-4-yl)acetamide (PubChem CID 13483368) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-methoxy-N-(5-methyl-1,2-oxazol-4-yl)acetamide.
Molecular Properties
| Compound Name | 2-methoxy-N-(5-methyl-1,2-oxazol-4-yl)acetamide |
| PubChem CID | 13483368 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 2-methoxy-N-(5-methyl-1,2-oxazol-4-yl)acetamide |
| SMILES | COCC(=O)Nc1cnoc1C |
| InChI | InChI=1S/C7H10N2O3/c1-5-6(3-8-12-5)9-7(10)4-11-2/h3H,4H2,1-2H3,(H,9,10) |
| InChIKey | PRGSJUGHKHZQCF-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-N-(5-methyl-1,2-oxazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-(5-methyl-1,2-oxazol-4-yl)acetamide?
The IUPAC name of 2-methoxy-N-(5-methyl-1,2-oxazol-4-yl)acetamide (CID 13483368) is 2-methoxy-N-(5-methyl-1,2-oxazol-4-yl)acetamide.
What is the SMILES notation for 2-methoxy-N-(5-methyl-1,2-oxazol-4-yl)acetamide?
The canonical SMILES for 2-methoxy-N-(5-methyl-1,2-oxazol-4-yl)acetamide is COCC(=O)Nc1cnoc1C.
What is the InChIKey of 2-methoxy-N-(5-methyl-1,2-oxazol-4-yl)acetamide?
The InChIKey is PRGSJUGHKHZQCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-5-6(3-8-12-5)9-7(10)4-11-2/h3H,4H2,1-2H3,(H,9,10).
What are the key properties of 2-methoxy-N-(5-methyl-1,2-oxazol-4-yl)acetamide?
2-methoxy-N-(5-methyl-1,2-oxazol-4-yl)acetamide has a molecular weight of 170.17 g/mol, XLogP of 0.57, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-(5-methyl-1,2-oxazol-4-yl)acetamide is sourced from PubChem (CID 13483368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).