About 2-(dimethylamino)-N-(5-methyl-1,2-oxazol-4-yl)acetamide
2-(dimethylamino)-N-(5-methyl-1,2-oxazol-4-yl)acetamide (PubChem CID 13483369) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-(dimethylamino)-N-(5-methyl-1,2-oxazol-4-yl)acetamide.
Molecular Properties
| Compound Name | 2-(dimethylamino)-N-(5-methyl-1,2-oxazol-4-yl)acetamide |
| PubChem CID | 13483369 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2-(dimethylamino)-N-(5-methyl-1,2-oxazol-4-yl)acetamide |
| SMILES | Cc1oncc1NC(=O)CN(C)C |
| InChI | InChI=1S/C8H13N3O2/c1-6-7(4-9-13-6)10-8(12)5-11(2)3/h4H,5H2,1-3H3,(H,10,12) |
| InChIKey | GZYBNSWLNVLGAV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(dimethylamino)-N-(5-methyl-1,2-oxazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-N-(5-methyl-1,2-oxazol-4-yl)acetamide?
The IUPAC name of 2-(dimethylamino)-N-(5-methyl-1,2-oxazol-4-yl)acetamide (CID 13483369) is 2-(dimethylamino)-N-(5-methyl-1,2-oxazol-4-yl)acetamide.
What is the SMILES notation for 2-(dimethylamino)-N-(5-methyl-1,2-oxazol-4-yl)acetamide?
The canonical SMILES for 2-(dimethylamino)-N-(5-methyl-1,2-oxazol-4-yl)acetamide is Cc1oncc1NC(=O)CN(C)C.
What is the InChIKey of 2-(dimethylamino)-N-(5-methyl-1,2-oxazol-4-yl)acetamide?
The InChIKey is GZYBNSWLNVLGAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-6-7(4-9-13-6)10-8(12)5-11(2)3/h4H,5H2,1-3H3,(H,10,12).
What are the key properties of 2-(dimethylamino)-N-(5-methyl-1,2-oxazol-4-yl)acetamide?
2-(dimethylamino)-N-(5-methyl-1,2-oxazol-4-yl)acetamide has a molecular weight of 183.21 g/mol, XLogP of 0.48, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-N-(5-methyl-1,2-oxazol-4-yl)acetamide is sourced from PubChem (CID 13483369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).