C25H38O14S — CID 134833701
[(3R,5S,6S)-5-hydroxy-6-propan-2-yloxy-3-[(2S,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 134833701) has the molecular formula C25H38O14S and a molecular weight of 594.63 g/mol. Its IUPAC name is [(3R,5S,6S)-5-hydroxy-6-propan-2-yloxy-3-[(2S,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,5S,6S)-5-hydroxy-6-propan-2-yloxy-3-[(2S,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134833701 |
| Molecular Formula | C25H38O14S |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | [(3R,5S,6S)-5-hydroxy-6-propan-2-yloxy-3-[(2S,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](S[C@@H]2C[C@H](O)[C@@H](OC(C)C)OC2COC(C)=O)C(OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H38O14S/c1-11(2)34-24-17(31)8-20(18(38-24)9-32-12(3)26)40-25-23(37-16(7)30)22(36-15(6)29)21(35-14(5)28)19(39-25)10-33-13(4)27/h11,17-25,31H,8-10H2,1-7H3/t17-,18?,19?,20+,21+,22?,23?,24-,25-/m0/s1 |
| InChIKey | IORIOTGLIPSQLD-ZFMAHNQISA-N |
| XLogP | 0.64 |
| TPSA | 179.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|