C10H15NO — CID 134833782
(1R,8aS)-1-ethenyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 134833782) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (1R,8aS)-1-ethenyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (1R,8aS)-1-ethenyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 134833782 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (1R,8aS)-1-ethenyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | C=C[C@H]1CCN2C(=O)CCC[C@@H]12 |
| InChI | InChI=1S/C10H15NO/c1-2-8-6-7-11-9(8)4-3-5-10(11)12/h2,8-9H,1,3-7H2/t8-,9-/m0/s1 |
| InChIKey | QIZJUNNNKPSLTB-IUCAKERBSA-N |
| XLogP | 1.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|