C28H43F3O3S — CID 134833817
[(8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-octyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate (PubChem CID 134833817) has the molecular formula C28H43F3O3S and a molecular weight of 516.71 g/mol. Its IUPAC name is [(8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-octyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate.
| Compound Name | [(8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-octyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134833817 |
| Molecular Formula | C28H43F3O3S |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | [(8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-octyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
| SMILES | CCCCCCCC[C@H]1CC[C@H]2[C@@H]3CC=C4C=C(OS(=O)(=O)C(F)(F)F)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H43F3O3S/c1-4-5-6-7-8-9-10-20-12-14-24-23-13-11-21-19-22(34-35(32,33)28(29,30)31)15-17-27(21,3)25(23)16-18-26(20,24)2/h11,19-20,23-25H,4-10,12-18H2,1-3H3/t20-,23-,24-,25-,26+,27-/m0/s1 |
| InChIKey | OYGWPCMDPIBWEC-FFUWBUQXSA-N |
| XLogP | 8.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|