C30H60O6Si3 — CID 134833862
[(2R,3R,4S)-3-[[(2R,3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-3,4-dihydro-2H-pyran-6-yl]oxy]-2-methyl-3,4-dihydro-2H-pyran-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134833862) has the molecular formula C30H60O6Si3 and a molecular weight of 601.06 g/mol. Its IUPAC name is [(2R,3R,4S)-3-[[(2R,3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-3,4-dihydro-2H-pyran-6-yl]oxy]-2-methyl-3,4-dihydro-2H-pyran-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,4S)-3-[[(2R,3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-3,4-dihydro-2H-pyran-6-yl]oxy]-2-methyl-3,4-dihydro-2H-pyran-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134833862 |
| Molecular Formula | C30H60O6Si3 |
| Molecular Weight | 601.06 g/mol |
| Exact Mass | 600.37 |
| IUPAC Name | [(2R,3R,4S)-3-[[(2R,3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-3,4-dihydro-2H-pyran-6-yl]oxy]-2-methyl-3,4-dihydro-2H-pyran-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H]1OC=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC1=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O1 |
| InChI | InChI=1S/C30H60O6Si3/c1-21-26(23(18-19-31-21)34-37(12,13)28(3,4)5)33-25-20-24(35-38(14,15)29(6,7)8)27(22(2)32-25)36-39(16,17)30(9,10)11/h18-24,26-27H,1-17H3/t21-,22-,23+,24+,26-,27-/m1/s1 |
| InChIKey | HRRKFVVFNJKTKH-UCDAUJGGSA-N |
| XLogP | 8.74 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.06 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|