C16H22O7S — CID 134833880
S-ethyl 2-[4-[(2R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanethioate (PubChem CID 134833880) has the molecular formula C16H22O7S and a molecular weight of 358.41 g/mol. Its IUPAC name is S-ethyl 2-[4-[(2R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanethioate.
| Compound Name | S-ethyl 2-[4-[(2R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanethioate |
|---|---|
| PubChem CID | 134833880 |
| Molecular Formula | C16H22O7S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | S-ethyl 2-[4-[(2R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanethioate |
| SMILES | CCSC(=O)Cc1ccc(O[C@H]2OC(CO)[C@@H](O)C(O)C2O)cc1 |
| InChI | InChI=1S/C16H22O7S/c1-2-24-12(18)7-9-3-5-10(6-4-9)22-16-15(21)14(20)13(19)11(8-17)23-16/h3-6,11,13-17,19-21H,2,7-8H2,1H3/t11?,13-,14?,15?,16+/m1/s1 |
| InChIKey | ICSJDFQHGHMXQL-ZHTAKHQHSA-N |
| XLogP | -0.31 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|