C30H37O8P — CID 134833905
(2S,5R)-3-dimethoxyphosphoryl-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 134833905) has the molecular formula C30H37O8P and a molecular weight of 556.59 g/mol. Its IUPAC name is (2S,5R)-3-dimethoxyphosphoryl-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,5R)-3-dimethoxyphosphoryl-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 134833905 |
| Molecular Formula | C30H37O8P |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | (2S,5R)-3-dimethoxyphosphoryl-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | CO[C@H]1OC(COCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C1P(=O)(OC)OC |
| InChI | InChI=1S/C30H37O8P/c1-32-30-29(39(31,33-2)34-3)28(37-21-25-17-11-6-12-18-25)27(36-20-24-15-9-5-10-16-24)26(38-30)22-35-19-23-13-7-4-8-14-23/h4-18,26-30H,19-22H2,1-3H3/t26?,27-,28?,29?,30+/m1/s1 |
| InChIKey | ZDRZHPWSEFYVHU-SKFMPKQFSA-N |
| XLogP | 5.60 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|