C40H46O13S — CID 134833909
[(3S,6S)-4,5-diacetyloxy-2-[[(6S,8aR)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanylmethyl]-6-methoxyoxan-3-yl] acetate (PubChem CID 134833909) has the molecular formula C40H46O13S and a molecular weight of 766.86 g/mol. Its IUPAC name is [(3S,6S)-4,5-diacetyloxy-2-[[(6S,8aR)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanylmethyl]-6-methoxyoxan-3-yl] acetate.
| Compound Name | [(3S,6S)-4,5-diacetyloxy-2-[[(6S,8aR)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanylmethyl]-6-methoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 134833909 |
| Molecular Formula | C40H46O13S |
| Molecular Weight | 766.86 g/mol |
| Exact Mass | 766.27 |
| IUPAC Name | [(3S,6S)-4,5-diacetyloxy-2-[[(6S,8aR)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanylmethyl]-6-methoxyoxan-3-yl] acetate |
| SMILES | CO[C@H]1OC(CS[C@@H]2OC3COC(c4ccccc4)O[C@H]3C(OCc3ccccc3)C2OCc2ccccc2)[C@@H](OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C40H46O13S/c1-24(41)48-33-31(51-39(44-4)36(50-26(3)43)35(33)49-25(2)42)23-54-40-37(46-21-28-16-10-6-11-17-28)34(45-20-27-14-8-5-9-15-27)32-30(52-40)22-47-38(53-32)29-18-12-7-13-19-29/h5-19,30-40H,20-23H2,1-4H3/t30?,31?,32-,33-,34?,35?,36?,37?,38?,39+,40+/m1/s1 |
| InChIKey | XJDTYTBXECGEHD-WQFXMWTFSA-N |
| XLogP | 4.90 |
| TPSA | 143.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.86 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|