C16H28O5 — CID 134834028
dimethyl (2R,5S)-5-butyl-2-(2-methylpropyl)oxolane-3,3-dicarboxylate (PubChem CID 134834028) has the molecular formula C16H28O5 and a molecular weight of 300.39 g/mol. Its IUPAC name is dimethyl (2R,5S)-5-butyl-2-(2-methylpropyl)oxolane-3,3-dicarboxylate.
| Compound Name | dimethyl (2R,5S)-5-butyl-2-(2-methylpropyl)oxolane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 134834028 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | dimethyl (2R,5S)-5-butyl-2-(2-methylpropyl)oxolane-3,3-dicarboxylate |
| SMILES | CCCC[C@H]1CC(C(=O)OC)(C(=O)OC)[C@@H](CC(C)C)O1 |
| InChI | InChI=1S/C16H28O5/c1-6-7-8-12-10-16(14(17)19-4,15(18)20-5)13(21-12)9-11(2)3/h11-13H,6-10H2,1-5H3/t12-,13+/m0/s1 |
| InChIKey | DLVDVLCBRWGUJS-QWHCGFSZSA-N |
| XLogP | 2.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|