About [(4S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-1-en-5-yn-4-yl] but-2-ynoate
[(4S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-1-en-5-yn-4-yl] but-2-ynoate (PubChem CID 134834140) has the molecular formula C18H28O3Si
and a molecular weight of 320.51 g/mol. Its IUPAC name is [(4S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-1-en-5-yn-4-yl] but-2-ynoate.
Molecular Properties
| Compound Name | [(4S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-1-en-5-yn-4-yl] but-2-ynoate |
| PubChem CID | 134834140 |
| Molecular Formula | C18H28O3Si |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | [(4S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-1-en-5-yn-4-yl] but-2-ynoate |
| SMILES | C=C(C)C[C@@H](C#CCO[Si](C)(C)C(C)(C)C)OC(=O)C#CC |
| InChI | InChI=1S/C18H28O3Si/c1-9-11-17(19)21-16(14-15(2)3)12-10-13-20-22(7,8)18(4,5)6/h16H,2,13-14H2,1,3-8H3/t16-/m1/s1 |
| InChIKey | BVBGUAYWBWRXEM-MRXNPFEDSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-1-en-5-yn-4-yl] but-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-1-en-5-yn-4-yl] but-2-ynoate?
The IUPAC name of [(4S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-1-en-5-yn-4-yl] but-2-ynoate (CID 134834140) is [(4S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-1-en-5-yn-4-yl] but-2-ynoate.
What is the SMILES notation for [(4S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-1-en-5-yn-4-yl] but-2-ynoate?
The canonical SMILES for [(4S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-1-en-5-yn-4-yl] but-2-ynoate is C=C(C)C[C@@H](C#CCO[Si](C)(C)C(C)(C)C)OC(=O)C#CC.
What is the InChIKey of [(4S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-1-en-5-yn-4-yl] but-2-ynoate?
The InChIKey is BVBGUAYWBWRXEM-MRXNPFEDSA-N. The full InChI is InChI=1S/C18H28O3Si/c1-9-11-17(19)21-16(14-15(2)3)12-10-13-20-22(7,8)18(4,5)6/h16H,2,13-14H2,1,3-8H3/t16-/m1/s1.
What are the key properties of [(4S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-1-en-5-yn-4-yl] but-2-ynoate?
[(4S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-1-en-5-yn-4-yl] but-2-ynoate has a molecular weight of 320.51 g/mol, XLogP of 3.91, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methylhept-1-en-5-yn-4-yl] but-2-ynoate is sourced from PubChem (CID 134834140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).