C16H23NO2 — CID 134834161
N-[(2R,3R)-2-phenyloxetan-3-yl]-N-propylbutanamide (PubChem CID 134834161) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-[(2R,3R)-2-phenyloxetan-3-yl]-N-propylbutanamide.
| Compound Name | N-[(2R,3R)-2-phenyloxetan-3-yl]-N-propylbutanamide |
|---|---|
| PubChem CID | 134834161 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-[(2R,3R)-2-phenyloxetan-3-yl]-N-propylbutanamide |
| SMILES | CCCC(=O)N(CCC)[C@@H]1CO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H23NO2/c1-3-8-15(18)17(11-4-2)14-12-19-16(14)13-9-6-5-7-10-13/h5-7,9-10,14,16H,3-4,8,11-12H2,1-2H3/t14-,16-/m1/s1 |
| InChIKey | IGVSSWAKCLHOAT-GDBMZVCRSA-N |
| XLogP | 3.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |