C11H21NO — CID 134834212
(NE)-N-[(3R)-2,2,3,4,4-pentamethylcyclohexylidene]hydroxylamine (PubChem CID 134834212) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (NE)-N-[(3R)-2,2,3,4,4-pentamethylcyclohexylidene]hydroxylamine.
| Compound Name | (NE)-N-[(3R)-2,2,3,4,4-pentamethylcyclohexylidene]hydroxylamine |
|---|---|
| PubChem CID | 134834212 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (NE)-N-[(3R)-2,2,3,4,4-pentamethylcyclohexylidene]hydroxylamine |
| SMILES | C[C@@H]1C(C)(C)CC/C(=N\O)C1(C)C |
| InChI | InChI=1S/C11H21NO/c1-8-10(2,3)7-6-9(12-13)11(8,4)5/h8,13H,6-7H2,1-5H3/b12-9+/t8-/m1/s1 |
| InChIKey | CJUUNEPJMAPUTN-WLDSJTMESA-N |
| XLogP | 3.30 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|