C39H48N4O2Si2 — CID 134834241
(2S,4S)-4-azido-5-[tert-butyl(diphenyl)silyl]oxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methylpentanenitrile (PubChem CID 134834241) has the molecular formula C39H48N4O2Si2 and a molecular weight of 661.01 g/mol. Its IUPAC name is (2S,4S)-4-azido-5-[tert-butyl(diphenyl)silyl]oxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methylpentanenitrile.
| Compound Name | (2S,4S)-4-azido-5-[tert-butyl(diphenyl)silyl]oxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methylpentanenitrile |
|---|---|
| PubChem CID | 134834241 |
| Molecular Formula | C39H48N4O2Si2 |
| Molecular Weight | 661.01 g/mol |
| Exact Mass | 660.33 |
| IUPAC Name | (2S,4S)-4-azido-5-[tert-butyl(diphenyl)silyl]oxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methylpentanenitrile |
| SMILES | CC(C)(C)[Si](OC[C@H](C[C@@](C)(C#N)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N=[N+]=[N-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H48N4O2Si2/c1-37(2,3)46(33-20-12-8-13-21-33,34-22-14-9-15-23-34)44-29-32(42-43-41)28-39(7,30-40)31-45-47(38(4,5)6,35-24-16-10-17-25-35)36-26-18-11-19-27-36/h8-27,32H,28-29,31H2,1-7H3/t32-,39-/m0/s1 |
| InChIKey | DCBLGVXHXHEKHV-GSSDHLSPSA-N |
| XLogP | 7.74 |
| TPSA | 91.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.01 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|