C15H19NO3 — CID 134834410
(2S,3R,5S,6R)-2,6-bis(furan-2-yl)-3,5-dimethylpiperidin-4-ol (PubChem CID 134834410) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is (2S,3R,5S,6R)-2,6-bis(furan-2-yl)-3,5-dimethylpiperidin-4-ol.
| Compound Name | (2S,3R,5S,6R)-2,6-bis(furan-2-yl)-3,5-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 134834410 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (2S,3R,5S,6R)-2,6-bis(furan-2-yl)-3,5-dimethylpiperidin-4-ol |
| SMILES | C[C@@H]1C(O)[C@H](C)[C@@H](c2ccco2)N[C@H]1c1ccco1 |
| InChI | InChI=1S/C15H19NO3/c1-9-13(11-5-3-7-18-11)16-14(10(2)15(9)17)12-6-4-8-19-12/h3-10,13-17H,1-2H3/t9-,10+,13+,14-,15? |
| InChIKey | FMJIBFXOWYNRGJ-XKWPVJITSA-N |
| XLogP | 2.89 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |