C16H26O4 — CID 134834438
methyl (4aS,8R,8aS)-8,8a-dimethylspiro[1,2,4,4a,5,6,7,8-octahydronaphthalene-3,2'-1,3-dioxolane]-2-carboxylate (PubChem CID 134834438) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is methyl (4aS,8R,8aS)-8,8a-dimethylspiro[1,2,4,4a,5,6,7,8-octahydronaphthalene-3,2'-1,3-dioxolane]-2-carboxylate.
| Compound Name | methyl (4aS,8R,8aS)-8,8a-dimethylspiro[1,2,4,4a,5,6,7,8-octahydronaphthalene-3,2'-1,3-dioxolane]-2-carboxylate |
|---|---|
| PubChem CID | 134834438 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | methyl (4aS,8R,8aS)-8,8a-dimethylspiro[1,2,4,4a,5,6,7,8-octahydronaphthalene-3,2'-1,3-dioxolane]-2-carboxylate |
| SMILES | COC(=O)C1C[C@]2(C)[C@@H](CCC[C@H]2C)CC12OCCO2 |
| InChI | InChI=1S/C16H26O4/c1-11-5-4-6-12-9-16(19-7-8-20-16)13(14(17)18-3)10-15(11,12)2/h11-13H,4-10H2,1-3H3/t11-,12+,13?,15+/m1/s1 |
| InChIKey | PECMUOPVYGIUDV-VSUHMYSYSA-N |
| XLogP | 2.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |