C18H27NO7 — CID 134834450
triethyl (2R,3S)-3-cyano-2-methyl-6-oxoheptane-1,1,3-tricarboxylate (PubChem CID 134834450) has the molecular formula C18H27NO7 and a molecular weight of 369.41 g/mol. Its IUPAC name is triethyl (2R,3S)-3-cyano-2-methyl-6-oxoheptane-1,1,3-tricarboxylate.
| Compound Name | triethyl (2R,3S)-3-cyano-2-methyl-6-oxoheptane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 134834450 |
| Molecular Formula | C18H27NO7 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | triethyl (2R,3S)-3-cyano-2-methyl-6-oxoheptane-1,1,3-tricarboxylate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H](C)[C@](C#N)(CCC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C18H27NO7/c1-6-24-15(21)14(16(22)25-7-2)13(5)18(11-19,10-9-12(4)20)17(23)26-8-3/h13-14H,6-10H2,1-5H3/t13-,18-/m1/s1 |
| InChIKey | GLOKDOIOBQYYSR-FZKQIMNGSA-N |
| XLogP | 1.81 |
| TPSA | 119.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|