C10H18O5 — CID 134834586
(2R,3R,4R)-3,4-bis(methoxymethoxy)-2-methyl-3,4-dihydro-2H-pyran (PubChem CID 134834586) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is (2R,3R,4R)-3,4-bis(methoxymethoxy)-2-methyl-3,4-dihydro-2H-pyran.
| Compound Name | (2R,3R,4R)-3,4-bis(methoxymethoxy)-2-methyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 134834586 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (2R,3R,4R)-3,4-bis(methoxymethoxy)-2-methyl-3,4-dihydro-2H-pyran |
| SMILES | COCO[C@@H]1[C@@H](C)OC=C[C@H]1OCOC |
| InChI | InChI=1S/C10H18O5/c1-8-10(15-7-12-3)9(4-5-13-8)14-6-11-2/h4-5,8-10H,6-7H2,1-3H3/t8-,9-,10-/m1/s1 |
| InChIKey | KVLSZAUYNRYCJW-OPRDCNLKSA-N |
| XLogP | 0.90 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|