C36H39ClN2O6S — CID 134834776
N'-[(3S,4R,5S,6S)-3-chloro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-N-(4-methylphenyl)sulfonylethanimidamide (PubChem CID 134834776) has the molecular formula C36H39ClN2O6S and a molecular weight of 663.24 g/mol. Its IUPAC name is N'-[(3S,4R,5S,6S)-3-chloro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-N-(4-methylphenyl)sulfonylethanimidamide.
| Compound Name | N'-[(3S,4R,5S,6S)-3-chloro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-N-(4-methylphenyl)sulfonylethanimidamide |
|---|---|
| PubChem CID | 134834776 |
| Molecular Formula | C36H39ClN2O6S |
| Molecular Weight | 663.24 g/mol |
| Exact Mass | 662.22 |
| IUPAC Name | N'-[(3S,4R,5S,6S)-3-chloro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-N-(4-methylphenyl)sulfonylethanimidamide |
| SMILES | C/C(=N/C1O[C@@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1Cl)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C36H39ClN2O6S/c1-26-18-20-31(21-19-26)46(40,41)39-27(2)38-36-33(37)35(44-24-30-16-10-5-11-17-30)34(43-23-29-14-8-4-9-15-29)32(45-36)25-42-22-28-12-6-3-7-13-28/h3-21,32-36H,22-25H2,1-2H3,(H,38,39)/t32-,33-,34-,35-,36?/m0/s1 |
| InChIKey | DJIWWIDATSXKSY-KXMLRWMJSA-N |
| XLogP | 6.41 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.24 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|