About 3-(5,6-dimethyloxan-2-yl)propan-1-ol
3-(5,6-dimethyloxan-2-yl)propan-1-ol (PubChem CID 134834799) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is 3-(5,6-dimethyloxan-2-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(5,6-dimethyloxan-2-yl)propan-1-ol |
| PubChem CID | 134834799 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 3-(5,6-dimethyloxan-2-yl)propan-1-ol |
| SMILES | CC1CCC(CCCO)OC1C |
| InChI | InChI=1S/C10H20O2/c1-8-5-6-10(4-3-7-11)12-9(8)2/h8-11H,3-7H2,1-2H3 |
| InChIKey | UQBHOGJBTFINPF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(5,6-dimethyloxan-2-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,6-dimethyloxan-2-yl)propan-1-ol?
The IUPAC name of 3-(5,6-dimethyloxan-2-yl)propan-1-ol (CID 134834799) is 3-(5,6-dimethyloxan-2-yl)propan-1-ol.
What is the SMILES notation for 3-(5,6-dimethyloxan-2-yl)propan-1-ol?
The canonical SMILES for 3-(5,6-dimethyloxan-2-yl)propan-1-ol is CC1CCC(CCCO)OC1C.
What is the InChIKey of 3-(5,6-dimethyloxan-2-yl)propan-1-ol?
The InChIKey is UQBHOGJBTFINPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2/c1-8-5-6-10(4-3-7-11)12-9(8)2/h8-11H,3-7H2,1-2H3.
What are the key properties of 3-(5,6-dimethyloxan-2-yl)propan-1-ol?
3-(5,6-dimethyloxan-2-yl)propan-1-ol has a molecular weight of 172.27 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,6-dimethyloxan-2-yl)propan-1-ol is sourced from PubChem (CID 134834799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).