About 1,8-dimethylpyrido[1,2-a]benzimidazole
1,8-dimethylpyrido[1,2-a]benzimidazole (PubChem CID 134834808) has the molecular formula C13H12N2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 1,8-dimethylpyrido[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 1,8-dimethylpyrido[1,2-a]benzimidazole |
| PubChem CID | 134834808 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1,8-dimethylpyrido[1,2-a]benzimidazole |
| SMILES | Cc1ccc2nc3cccc(C)n3c2c1 |
| InChI | InChI=1S/C13H12N2/c1-9-6-7-11-12(8-9)15-10(2)4-3-5-13(15)14-11/h3-8H,1-2H3 |
| InChIKey | PAOWZAYDSNXKEM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,8-dimethylpyrido[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dimethylpyrido[1,2-a]benzimidazole?
The IUPAC name of 1,8-dimethylpyrido[1,2-a]benzimidazole (CID 134834808) is 1,8-dimethylpyrido[1,2-a]benzimidazole.
What is the SMILES notation for 1,8-dimethylpyrido[1,2-a]benzimidazole?
The canonical SMILES for 1,8-dimethylpyrido[1,2-a]benzimidazole is Cc1ccc2nc3cccc(C)n3c2c1.
What is the InChIKey of 1,8-dimethylpyrido[1,2-a]benzimidazole?
The InChIKey is PAOWZAYDSNXKEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2/c1-9-6-7-11-12(8-9)15-10(2)4-3-5-13(15)14-11/h3-8H,1-2H3.
What are the key properties of 1,8-dimethylpyrido[1,2-a]benzimidazole?
1,8-dimethylpyrido[1,2-a]benzimidazole has a molecular weight of 196.25 g/mol, XLogP of 3.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dimethylpyrido[1,2-a]benzimidazole is sourced from PubChem (CID 134834808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).