C41H52O4Si — CID 134834817
(2R,9S)-2-[tert-butyl(diphenyl)silyl]oxy-9,11-bis(phenylmethoxy)undecan-5-one (PubChem CID 134834817) has the molecular formula C41H52O4Si and a molecular weight of 636.95 g/mol. Its IUPAC name is (2R,9S)-2-[tert-butyl(diphenyl)silyl]oxy-9,11-bis(phenylmethoxy)undecan-5-one.
| Compound Name | (2R,9S)-2-[tert-butyl(diphenyl)silyl]oxy-9,11-bis(phenylmethoxy)undecan-5-one |
|---|---|
| PubChem CID | 134834817 |
| Molecular Formula | C41H52O4Si |
| Molecular Weight | 636.95 g/mol |
| Exact Mass | 636.36 |
| IUPAC Name | (2R,9S)-2-[tert-butyl(diphenyl)silyl]oxy-9,11-bis(phenylmethoxy)undecan-5-one |
| SMILES | C[C@H](CCC(=O)CCC[C@@H](CCOCc1ccccc1)OCc1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C41H52O4Si/c1-34(45-46(41(2,3)4,39-24-13-7-14-25-39)40-26-15-8-16-27-40)28-29-37(42)22-17-23-38(44-33-36-20-11-6-12-21-36)30-31-43-32-35-18-9-5-10-19-35/h5-16,18-21,24-27,34,38H,17,22-23,28-33H2,1-4H3/t34-,38+/m1/s1 |
| InChIKey | BCVOONWAADOZRW-BYYXFNHRSA-N |
| XLogP | 8.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.95 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|