C10H19IO2 — CID 134834892
3-(5,6-dimethyloxan-2-yl)propyl hypoiodite (PubChem CID 134834892) has the molecular formula C10H19IO2 and a molecular weight of 298.16 g/mol. Its IUPAC name is 3-(5,6-dimethyloxan-2-yl)propyl hypoiodite.
| Compound Name | 3-(5,6-dimethyloxan-2-yl)propyl hypoiodite |
|---|---|
| PubChem CID | 134834892 |
| Molecular Formula | C10H19IO2 |
| Molecular Weight | 298.16 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 3-(5,6-dimethyloxan-2-yl)propyl hypoiodite |
| SMILES | CC1CCC(CCCOI)OC1C |
| InChI | InChI=1S/C10H19IO2/c1-8-5-6-10(13-9(8)2)4-3-7-12-11/h8-10H,3-7H2,1-2H3 |
| InChIKey | CXCSJGWNZVQZJW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.16 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|