C24H36N6 — CID 134834922
3-[(2Z,4Z)-5-(4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl)-3,4-dimethylhexa-2,4-dien-2-yl]-4,5,6,7,8,9-hexahydrocycloocta[d]triazole (PubChem CID 134834922) has the molecular formula C24H36N6 and a molecular weight of 408.59 g/mol. Its IUPAC name is 3-[(2Z,4Z)-5-(4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl)-3,4-dimethylhexa-2,4-dien-2-yl]-4,5,6,7,8,9-hexahydrocycloocta[d]triazole.
| Compound Name | 3-[(2Z,4Z)-5-(4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl)-3,4-dimethylhexa-2,4-dien-2-yl]-4,5,6,7,8,9-hexahydrocycloocta[d]triazole |
|---|---|
| PubChem CID | 134834922 |
| Molecular Formula | C24H36N6 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | 3-[(2Z,4Z)-5-(4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl)-3,4-dimethylhexa-2,4-dien-2-yl]-4,5,6,7,8,9-hexahydrocycloocta[d]triazole |
| SMILES | CC(/C(C)=C(/C)n1nnc2c1CCCCCC2)=C(\C)n1nnc2c1CCCCCC2 |
| InChI | InChI=1S/C24H36N6/c1-17(19(3)29-23-15-11-7-5-9-13-21(23)25-27-29)18(2)20(4)30-24-16-12-8-6-10-14-22(24)26-28-30/h5-16H2,1-4H3/b19-17-,20-18- |
| InChIKey | YUFLUJHVDXBJKW-CLFAGFIQSA-N |
| XLogP | 5.39 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|