C20H40O3Si — CID 134835026
4-[(1R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)-2,6,6-trimethylcyclohex-2-en-1-yl]butan-2-ol (PubChem CID 134835026) has the molecular formula C20H40O3Si and a molecular weight of 356.62 g/mol. Its IUPAC name is 4-[(1R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)-2,6,6-trimethylcyclohex-2-en-1-yl]butan-2-ol.
| Compound Name | 4-[(1R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)-2,6,6-trimethylcyclohex-2-en-1-yl]butan-2-ol |
|---|---|
| PubChem CID | 134835026 |
| Molecular Formula | C20H40O3Si |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 4-[(1R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)-2,6,6-trimethylcyclohex-2-en-1-yl]butan-2-ol |
| SMILES | CC1=CC(O[Si](C)(C)C(C)(C)C)CC(C)(C)[C@]1(CO)CCC(C)O |
| InChI | InChI=1S/C20H40O3Si/c1-15-12-17(23-24(8,9)18(3,4)5)13-19(6,7)20(15,14-21)11-10-16(2)22/h12,16-17,21-22H,10-11,13-14H2,1-9H3/t16?,17?,20-/m0/s1 |
| InChIKey | IZPMKUCWXSFAQE-UHYCVJNDSA-N |
| XLogP | 4.89 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|