C25H45NO7SSi — CID 134835028
[(4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylmethoxyhexyl] methanesulfonate (PubChem CID 134835028) has the molecular formula C25H45NO7SSi and a molecular weight of 531.79 g/mol. Its IUPAC name is [(4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylmethoxyhexyl] methanesulfonate.
| Compound Name | [(4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylmethoxyhexyl] methanesulfonate |
|---|---|
| PubChem CID | 134835028 |
| Molecular Formula | C25H45NO7SSi |
| Molecular Weight | 531.79 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | [(4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylmethoxyhexyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](CCCOS(C)(=O)=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H45NO7SSi/c1-24(2,3)33-23(27)26-21(19-32-35(8,9)25(4,5)6)22(16-13-17-31-34(7,28)29)30-18-20-14-11-10-12-15-20/h10-12,14-15,21-22H,13,16-19H2,1-9H3,(H,26,27)/t21-,22+/m0/s1 |
| InChIKey | GOGPAWITGLRJBL-FCHUYYIVSA-N |
| XLogP | 5.24 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.79 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|