C18H30O4Si — CID 134835114
(1R,4aR,5S,8aS)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-prop-1-enyl]-4,4a,5,6,7,8a-hexahydro-1H-isochromene-3,8-dione (PubChem CID 134835114) has the molecular formula C18H30O4Si and a molecular weight of 338.52 g/mol. Its IUPAC name is (1R,4aR,5S,8aS)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-prop-1-enyl]-4,4a,5,6,7,8a-hexahydro-1H-isochromene-3,8-dione.
| Compound Name | (1R,4aR,5S,8aS)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-prop-1-enyl]-4,4a,5,6,7,8a-hexahydro-1H-isochromene-3,8-dione |
|---|---|
| PubChem CID | 134835114 |
| Molecular Formula | C18H30O4Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (1R,4aR,5S,8aS)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-prop-1-enyl]-4,4a,5,6,7,8a-hexahydro-1H-isochromene-3,8-dione |
| SMILES | C/C=C/[C@H]1OC(=O)C[C@@H]2[C@@H]1C(=O)CC[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H30O4Si/c1-7-8-15-17-12(11-16(20)21-15)14(10-9-13(17)19)22-23(5,6)18(2,3)4/h7-8,12,14-15,17H,9-11H2,1-6H3/b8-7+/t12-,14-,15+,17+/m0/s1 |
| InChIKey | BWBBCMKCRLFKQO-ALSMUBRRSA-N |
| XLogP | 3.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|