C24H46O4Si3 — CID 134835117
trimethylsilyl (1S,2S,4aR,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-trimethylsilyloxy-1,2,4a,7,8,8a-hexahydronaphthalene-1-carboxylate (PubChem CID 134835117) has the molecular formula C24H46O4Si3 and a molecular weight of 482.89 g/mol. Its IUPAC name is trimethylsilyl (1S,2S,4aR,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-trimethylsilyloxy-1,2,4a,7,8,8a-hexahydronaphthalene-1-carboxylate.
| Compound Name | trimethylsilyl (1S,2S,4aR,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-trimethylsilyloxy-1,2,4a,7,8,8a-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 134835117 |
| Molecular Formula | C24H46O4Si3 |
| Molecular Weight | 482.89 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | trimethylsilyl (1S,2S,4aR,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-trimethylsilyloxy-1,2,4a,7,8,8a-hexahydronaphthalene-1-carboxylate |
| SMILES | C[C@H]1C=C[C@H]2C(O[Si](C)(C)C)=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2[C@H]1C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C24H46O4Si3/c1-17-13-14-18-19(26-29(5,6)7)15-16-20(27-31(11,12)24(2,3)4)22(18)21(17)23(25)28-30(8,9)10/h13-15,17-18,20-22H,16H2,1-12H3/t17-,18-,20-,21-,22+/m0/s1 |
| InChIKey | KRMPRMCVAIDRCG-OOOLTRJPSA-N |
| XLogP | 6.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.89 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|