C25H40O5 — CID 134835162
[(1S,7S,8S,8aR)-8-[2-[(2R,4R,6S)-6-ethoxy-4-hydroxyoxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate (PubChem CID 134835162) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is [(1S,7S,8S,8aR)-8-[2-[(2R,4R,6S)-6-ethoxy-4-hydroxyoxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate.
| Compound Name | [(1S,7S,8S,8aR)-8-[2-[(2R,4R,6S)-6-ethoxy-4-hydroxyoxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate |
|---|---|
| PubChem CID | 134835162 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | [(1S,7S,8S,8aR)-8-[2-[(2R,4R,6S)-6-ethoxy-4-hydroxyoxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate |
| SMILES | CCO[C@@H]1C[C@H](O)C[C@@H](CC[C@@H]2[C@@H]3C(=CCC[C@@H]3OC(=O)[C@@H](C)CC)C=C[C@@H]2C)O1 |
| InChI | InChI=1S/C25H40O5/c1-5-16(3)25(27)30-22-9-7-8-18-11-10-17(4)21(24(18)22)13-12-20-14-19(26)15-23(29-20)28-6-2/h8,10-11,16-17,19-24,26H,5-7,9,12-15H2,1-4H3/t16-,17-,19+,20+,21-,22-,23-,24-/m0/s1 |
| InChIKey | LWNJEDLNGOTFCR-MCHUOXAESA-N |
| XLogP | 4.79 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |