About (4E)-6-methoxy-N,N-dimethylhepta-4,6-dienamide
(4E)-6-methoxy-N,N-dimethylhepta-4,6-dienamide (PubChem CID 13483522) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is (4E)-6-methoxy-N,N-dimethylhepta-4,6-dienamide.
Molecular Properties
| Compound Name | (4E)-6-methoxy-N,N-dimethylhepta-4,6-dienamide |
| PubChem CID | 13483522 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (4E)-6-methoxy-N,N-dimethylhepta-4,6-dienamide |
| SMILES | C=C(/C=C/CCC(=O)N(C)C)OC |
| InChI | InChI=1S/C10H17NO2/c1-9(13-4)7-5-6-8-10(12)11(2)3/h5,7H,1,6,8H2,2-4H3/b7-5+ |
| InChIKey | FOGPCOXZSCSDMZ-FNORWQNLSA-N |
| XLogP | 1.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-6-methoxy-N,N-dimethylhepta-4,6-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-6-methoxy-N,N-dimethylhepta-4,6-dienamide?
The IUPAC name of (4E)-6-methoxy-N,N-dimethylhepta-4,6-dienamide (CID 13483522) is (4E)-6-methoxy-N,N-dimethylhepta-4,6-dienamide.
What is the SMILES notation for (4E)-6-methoxy-N,N-dimethylhepta-4,6-dienamide?
The canonical SMILES for (4E)-6-methoxy-N,N-dimethylhepta-4,6-dienamide is C=C(/C=C/CCC(=O)N(C)C)OC.
What is the InChIKey of (4E)-6-methoxy-N,N-dimethylhepta-4,6-dienamide?
The InChIKey is FOGPCOXZSCSDMZ-FNORWQNLSA-N. The full InChI is InChI=1S/C10H17NO2/c1-9(13-4)7-5-6-8-10(12)11(2)3/h5,7H,1,6,8H2,2-4H3/b7-5+.
What are the key properties of (4E)-6-methoxy-N,N-dimethylhepta-4,6-dienamide?
(4E)-6-methoxy-N,N-dimethylhepta-4,6-dienamide has a molecular weight of 183.25 g/mol, XLogP of 1.57, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-6-methoxy-N,N-dimethylhepta-4,6-dienamide is sourced from PubChem (CID 13483522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).