C10H17NO — CID 13483524
(4E)-N,N,6-trimethylhepta-4,6-dienamide (PubChem CID 13483524) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (4E)-N,N,6-trimethylhepta-4,6-dienamide.
| Compound Name | (4E)-N,N,6-trimethylhepta-4,6-dienamide |
|---|---|
| PubChem CID | 13483524 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (4E)-N,N,6-trimethylhepta-4,6-dienamide |
| SMILES | C=C(C)/C=C/CCC(=O)N(C)C |
| InChI | InChI=1S/C10H17NO/c1-9(2)7-5-6-8-10(12)11(3)4/h5,7H,1,6,8H2,2-4H3/b7-5+ |
| InChIKey | PXDVXAFQDNVBMQ-FNORWQNLSA-N |
| XLogP | 1.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|