C19H22N2O2 — CID 134835242
(2S,5S,6S)-2-(benzylamino)-4,5-dimethyl-6-phenylmorpholin-3-one (PubChem CID 134835242) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (2S,5S,6S)-2-(benzylamino)-4,5-dimethyl-6-phenylmorpholin-3-one.
| Compound Name | (2S,5S,6S)-2-(benzylamino)-4,5-dimethyl-6-phenylmorpholin-3-one |
|---|---|
| PubChem CID | 134835242 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (2S,5S,6S)-2-(benzylamino)-4,5-dimethyl-6-phenylmorpholin-3-one |
| SMILES | C[C@H]1[C@H](c2ccccc2)O[C@H](NCc2ccccc2)C(=O)N1C |
| InChI | InChI=1S/C19H22N2O2/c1-14-17(16-11-7-4-8-12-16)23-18(19(22)21(14)2)20-13-15-9-5-3-6-10-15/h3-12,14,17-18,20H,13H2,1-2H3/t14-,17+,18-/m0/s1 |
| InChIKey | FFEVNTAUZWRTCP-QGTPRVQTSA-N |
| XLogP | 2.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |