C15H22O3 — CID 134835253
[(1R,2S,8S)-5,5-dimethylspiro[4,6-dioxatricyclo[7.2.1.02,8]dodec-10-ene-12,2'-cyclopropane]-1'-yl]methanol (PubChem CID 134835253) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is [(1R,2S,8S)-5,5-dimethylspiro[4,6-dioxatricyclo[7.2.1.02,8]dodec-10-ene-12,2'-cyclopropane]-1'-yl]methanol.
| Compound Name | [(1R,2S,8S)-5,5-dimethylspiro[4,6-dioxatricyclo[7.2.1.02,8]dodec-10-ene-12,2'-cyclopropane]-1'-yl]methanol |
|---|---|
| PubChem CID | 134835253 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | [(1R,2S,8S)-5,5-dimethylspiro[4,6-dioxatricyclo[7.2.1.02,8]dodec-10-ene-12,2'-cyclopropane]-1'-yl]methanol |
| SMILES | CC1(C)OC[C@H]2[C@H]3C=CC([C@@H]2CO1)C31CC1CO |
| InChI | InChI=1S/C15H22O3/c1-14(2)17-7-10-11(8-18-14)13-4-3-12(10)15(13)5-9(15)6-16/h3-4,9-13,16H,5-8H2,1-2H3/t9?,10-,11-,12-,13?,15?/m1/s1 |
| InChIKey | RHTYHUKVGONBSR-BIQGACQUSA-N |
| XLogP | 1.82 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|