C19H36O2Si2 — CID 134835256
(3aS,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-3-(trimethylsilylmethylidene)-2,3a,5,6,7,7a-hexahydro-1H-inden-4-one (PubChem CID 134835256) has the molecular formula C19H36O2Si2 and a molecular weight of 352.67 g/mol. Its IUPAC name is (3aS,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-3-(trimethylsilylmethylidene)-2,3a,5,6,7,7a-hexahydro-1H-inden-4-one.
| Compound Name | (3aS,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-3-(trimethylsilylmethylidene)-2,3a,5,6,7,7a-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 134835256 |
| Molecular Formula | C19H36O2Si2 |
| Molecular Weight | 352.67 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | (3aS,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-3-(trimethylsilylmethylidene)-2,3a,5,6,7,7a-hexahydro-1H-inden-4-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC(=O)[C@@H]2C(=C[Si](C)(C)C)CC[C@@H]21 |
| InChI | InChI=1S/C19H36O2Si2/c1-19(2,3)23(7,8)21-17-12-11-16(20)18-14(9-10-15(17)18)13-22(4,5)6/h13,15,17-18H,9-12H2,1-8H3/t15-,17+,18-/m1/s1 |
| InChIKey | JCSMFTMKRYZECT-BPQIPLTHSA-N |
| XLogP | 5.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|