C16H24O3 — CID 134835336
methyl 3-[(1S,2S,4aR,6S,8aS)-2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-oxopropanoate (PubChem CID 134835336) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is methyl 3-[(1S,2S,4aR,6S,8aS)-2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-oxopropanoate.
| Compound Name | methyl 3-[(1S,2S,4aR,6S,8aS)-2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 134835336 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | methyl 3-[(1S,2S,4aR,6S,8aS)-2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)[C@@H]1[C@H]2CC[C@H](C)C[C@@H]2C=C[C@@H]1C |
| InChI | InChI=1S/C16H24O3/c1-10-4-7-13-12(8-10)6-5-11(2)16(13)14(17)9-15(18)19-3/h5-6,10-13,16H,4,7-9H2,1-3H3/t10-,11-,12-,13-,16-/m0/s1 |
| InChIKey | YMMNFEAGVWQMHQ-YTORKDELSA-N |
| XLogP | 2.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|